CAS No: 480438-75-3, Chemical Name: tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl carbonate
the physical and chemical property of 480438-75-3, tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl carbonate is provided by ChemNet.com
ChemNet > CAS > 480438-75-3 tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl carbonate
480438-75-3 tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl carbonate
Nama produk |
tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl carbonate |
Sinonim |
Carbonic acid, 1,1-dimethylethyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl ester; tert-Butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl carbonate; 4-hydroxy-2-nitrobenzoic acid |
MF |
C7H5NO5 |
Berat Molekul |
183.1183 |
InChI |
InChI=1/C7H5NO5/c9-4-1-2-5(7(10)11)6(3-4)8(12)13/h1-3,9H,(H,10,11) |
CAS NO |
480438-75-3 |
Struktur Molekul |
|
Kepadatan |
1.631g/cm3 |
Titik didih |
414°C at 760 mmHg |
Indeks bias |
1.663 |
Titik nyala |
190.8°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
|
|